C24H29NO7Si — CID 11236781
5-(2-methoxy-5-trimethylsilylphenoxy)-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide (PubChem CID 11236781) has the molecular formula C24H29NO7Si and a molecular weight of 471.58 g/mol. Its IUPAC name is 5-(2-methoxy-5-trimethylsilylphenoxy)-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide.
| Compound Name | 5-(2-methoxy-5-trimethylsilylphenoxy)-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 11236781 |
| Molecular Formula | C24H29NO7Si |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 5-(2-methoxy-5-trimethylsilylphenoxy)-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)c2ccc(Oc3cc([Si](C)(C)C)ccc3OC)o2)c(OC)c1 |
| InChI | InChI=1S/C24H29NO7Si/c1-27-15-12-20(29-3)23(21(13-15)30-4)25-24(26)18-10-11-22(31-18)32-19-14-16(33(5,6)7)8-9-17(19)28-2/h8-14H,1-7H3,(H,25,26) |
| InChIKey | HYJKYUZWLVJZJM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|