C23H20N2O6 — CID 10273631
5-quinolin-8-yloxy-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide (PubChem CID 10273631) has the molecular formula C23H20N2O6 and a molecular weight of 420.42 g/mol. Its IUPAC name is 5-quinolin-8-yloxy-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide.
| Compound Name | 5-quinolin-8-yloxy-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 10273631 |
| Molecular Formula | C23H20N2O6 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 5-quinolin-8-yloxy-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)c2ccc(Oc3cccc4cccnc34)o2)c(OC)c1 |
| InChI | InChI=1S/C23H20N2O6/c1-27-15-12-18(28-2)22(19(13-15)29-3)25-23(26)17-9-10-20(31-17)30-16-8-4-6-14-7-5-11-24-21(14)16/h4-13H,1-3H3,(H,25,26) |
| InChIKey | VMVWCZPNGPPIMQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |