C15H12N2O6S — CID 69058052
5-[(6-methoxyquinolin-8-yl)sulfamoyl]furan-2-carboxylic acid (PubChem CID 69058052) has the molecular formula C15H12N2O6S and a molecular weight of 348.34 g/mol. Its IUPAC name is 5-[(6-methoxyquinolin-8-yl)sulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-[(6-methoxyquinolin-8-yl)sulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 69058052 |
| Molecular Formula | C15H12N2O6S |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 5-[(6-methoxyquinolin-8-yl)sulfamoyl]furan-2-carboxylic acid |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(C(=O)O)o2)c2ncccc2c1 |
| InChI | InChI=1S/C15H12N2O6S/c1-22-10-7-9-3-2-6-16-14(9)11(8-10)17-24(20,21)13-5-4-12(23-13)15(18)19/h2-8,17H,1H3,(H,18,19) |
| InChIKey | QCOMMJDNQRVGMZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 118.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |