C10H8N2O5S — CID 29077337
5-(pyridin-4-ylsulfamoyl)furan-2-carboxylic acid (PubChem CID 29077337) has the molecular formula C10H8N2O5S and a molecular weight of 268.25 g/mol. Its IUPAC name is 5-(pyridin-4-ylsulfamoyl)furan-2-carboxylic acid.
| Compound Name | 5-(pyridin-4-ylsulfamoyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 29077337 |
| Molecular Formula | C10H8N2O5S |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 5-(pyridin-4-ylsulfamoyl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Nc2ccncc2)o1 |
| InChI | InChI=1S/C10H8N2O5S/c13-10(14)8-1-2-9(17-8)18(15,16)12-7-3-5-11-6-4-7/h1-6H,(H,11,12)(H,13,14) |
| InChIKey | LFJONXAJMPOBGM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |