C11H7BrFNO5S — CID 104775672
5-[(3-bromo-4-fluorophenyl)sulfamoyl]furan-2-carboxylic acid (PubChem CID 104775672) has the molecular formula C11H7BrFNO5S and a molecular weight of 364.15 g/mol. Its IUPAC name is 5-[(3-bromo-4-fluorophenyl)sulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-[(3-bromo-4-fluorophenyl)sulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 104775672 |
| Molecular Formula | C11H7BrFNO5S |
| Molecular Weight | 364.15 g/mol |
| Exact Mass | 362.92 |
| IUPAC Name | 5-[(3-bromo-4-fluorophenyl)sulfamoyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Nc2ccc(F)c(Br)c2)o1 |
| InChI | InChI=1S/C11H7BrFNO5S/c12-7-5-6(1-2-8(7)13)14-20(17,18)10-4-3-9(19-10)11(15)16/h1-5,14H,(H,15,16) |
| InChIKey | QTGPRBCNLSXCLL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.15 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |