C24H29NO8Si — CID 69371762
5-(2-methoxy-5-trimethylsilylphenoxy)-3-oxo-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide (PubChem CID 69371762) has the molecular formula C24H29NO8Si and a molecular weight of 487.58 g/mol. Its IUPAC name is 5-(2-methoxy-5-trimethylsilylphenoxy)-3-oxo-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide.
| Compound Name | 5-(2-methoxy-5-trimethylsilylphenoxy)-3-oxo-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 69371762 |
| Molecular Formula | C24H29NO8Si |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 5-(2-methoxy-5-trimethylsilylphenoxy)-3-oxo-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)C2OC(Oc3cc([Si](C)(C)C)ccc3OC)=CC2=O)c(OC)c1 |
| InChI | InChI=1S/C24H29NO8Si/c1-28-14-10-19(30-3)22(20(11-14)31-4)25-24(27)23-16(26)13-21(33-23)32-18-12-15(34(5,6)7)8-9-17(18)29-2/h8-13,23H,1-7H3,(H,25,27) |
| InChIKey | HMPWJWYJLPQABO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|