C27H35NO6Si — CID 69369586
N-(2,6-dimethoxyphenyl)-5-[5-[2,2-dimethylpropyl(dimethyl)silyl]-2-methylphenoxy]-3-oxofuran-2-carboxamide (PubChem CID 69369586) has the molecular formula C27H35NO6Si and a molecular weight of 497.66 g/mol. Its IUPAC name is N-(2,6-dimethoxyphenyl)-5-[5-[2,2-dimethylpropyl(dimethyl)silyl]-2-methylphenoxy]-3-oxofuran-2-carboxamide.
| Compound Name | N-(2,6-dimethoxyphenyl)-5-[5-[2,2-dimethylpropyl(dimethyl)silyl]-2-methylphenoxy]-3-oxofuran-2-carboxamide |
|---|---|
| PubChem CID | 69369586 |
| Molecular Formula | C27H35NO6Si |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | N-(2,6-dimethoxyphenyl)-5-[5-[2,2-dimethylpropyl(dimethyl)silyl]-2-methylphenoxy]-3-oxofuran-2-carboxamide |
| SMILES | COc1cccc(OC)c1NC(=O)C1OC(Oc2cc([Si](C)(C)CC(C)(C)C)ccc2C)=CC1=O |
| InChI | InChI=1S/C27H35NO6Si/c1-17-12-13-18(35(7,8)16-27(2,3)4)14-22(17)33-23-15-19(29)25(34-23)26(30)28-24-20(31-5)10-9-11-21(24)32-6/h9-15,25H,16H2,1-8H3,(H,28,30) |
| InChIKey | UHJXAPDUJUSSKP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|