C25H29NO8Si — CID 69401601
3-oxo-N-(2,4,6-trimethoxyphenyl)-5-[(4,4,7-trimethyl-2,3-dihydro-1,4-benzoxasilin-6-yl)oxy]furan-2-carboxamide (PubChem CID 69401601) has the molecular formula C25H29NO8Si and a molecular weight of 499.59 g/mol. Its IUPAC name is 3-oxo-N-(2,4,6-trimethoxyphenyl)-5-[(4,4,7-trimethyl-2,3-dihydro-1,4-benzoxasilin-6-yl)oxy]furan-2-carboxamide.
| Compound Name | 3-oxo-N-(2,4,6-trimethoxyphenyl)-5-[(4,4,7-trimethyl-2,3-dihydro-1,4-benzoxasilin-6-yl)oxy]furan-2-carboxamide |
|---|---|
| PubChem CID | 69401601 |
| Molecular Formula | C25H29NO8Si |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 3-oxo-N-(2,4,6-trimethoxyphenyl)-5-[(4,4,7-trimethyl-2,3-dihydro-1,4-benzoxasilin-6-yl)oxy]furan-2-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)C2OC(Oc3cc4c(cc3C)OCC[Si]4(C)C)=CC2=O)c(OC)c1 |
| InChI | InChI=1S/C25H29NO8Si/c1-14-9-18-21(35(5,6)8-7-32-18)13-17(14)33-22-12-16(27)24(34-22)25(28)26-23-19(30-3)10-15(29-2)11-20(23)31-4/h9-13,24H,7-8H2,1-6H3,(H,26,28) |
| InChIKey | YQIOIIODXNRGKK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|