C25H28ClNO7Si — CID 69401773
5-[(6-chloro-1,1-dimethyl-3,4-dihydro-2H-1-benzosilin-7-yl)oxy]-3-oxo-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide (PubChem CID 69401773) has the molecular formula C25H28ClNO7Si and a molecular weight of 518.04 g/mol. Its IUPAC name is 5-[(6-chloro-1,1-dimethyl-3,4-dihydro-2H-1-benzosilin-7-yl)oxy]-3-oxo-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide.
| Compound Name | 5-[(6-chloro-1,1-dimethyl-3,4-dihydro-2H-1-benzosilin-7-yl)oxy]-3-oxo-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 69401773 |
| Molecular Formula | C25H28ClNO7Si |
| Molecular Weight | 518.04 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | 5-[(6-chloro-1,1-dimethyl-3,4-dihydro-2H-1-benzosilin-7-yl)oxy]-3-oxo-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)C2OC(Oc3cc4c(cc3Cl)CCC[Si]4(C)C)=CC2=O)c(OC)c1 |
| InChI | InChI=1S/C25H28ClNO7Si/c1-30-15-10-19(31-2)23(20(11-15)32-3)27-25(29)24-17(28)12-22(34-24)33-18-13-21-14(9-16(18)26)7-6-8-35(21,4)5/h9-13,24H,6-8H2,1-5H3,(H,27,29) |
| InChIKey | XEGLRWDNJNBJAT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.04 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|