C26H34N4O8Si — CID 11376377
methyl 4-[[4,6-dimethoxy-5-[[5-(2-methoxy-5-trimethylsilylphenoxy)furan-2-carbonyl]amino]pyrimidin-2-yl]amino]butanoate (PubChem CID 11376377) has the molecular formula C26H34N4O8Si and a molecular weight of 558.66 g/mol. Its IUPAC name is methyl 4-[[4,6-dimethoxy-5-[[5-(2-methoxy-5-trimethylsilylphenoxy)furan-2-carbonyl]amino]pyrimidin-2-yl]amino]butanoate.
| Compound Name | methyl 4-[[4,6-dimethoxy-5-[[5-(2-methoxy-5-trimethylsilylphenoxy)furan-2-carbonyl]amino]pyrimidin-2-yl]amino]butanoate |
|---|---|
| PubChem CID | 11376377 |
| Molecular Formula | C26H34N4O8Si |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | methyl 4-[[4,6-dimethoxy-5-[[5-(2-methoxy-5-trimethylsilylphenoxy)furan-2-carbonyl]amino]pyrimidin-2-yl]amino]butanoate |
| SMILES | COC(=O)CCCNc1nc(OC)c(NC(=O)c2ccc(Oc3cc([Si](C)(C)C)ccc3OC)o2)c(OC)n1 |
| InChI | InChI=1S/C26H34N4O8Si/c1-33-17-11-10-16(39(5,6)7)15-19(17)38-21-13-12-18(37-21)23(32)28-22-24(35-3)29-26(30-25(22)36-4)27-14-8-9-20(31)34-2/h10-13,15H,8-9,14H2,1-7H3,(H,28,32)(H,27,29,30) |
| InChIKey | JKDSMRBRBGBVCO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 143.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|