C26H32N2O5VW-2 — CID 166167986
aminomethylidenetungsten;[1,3-dimethoxy-2-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)oxy]furan-2-carbonyl]amino]prop-2-enylidene]vanadium (PubChem CID 166167986) has the molecular formula C26H32N2O5VW-2 and a molecular weight of 687.34 g/mol. Its IUPAC name is aminomethylidenetungsten;[1,3-dimethoxy-2-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)oxy]furan-2-carbonyl]amino]prop-2-enylidene]vanadium.
| Compound Name | aminomethylidenetungsten;[1,3-dimethoxy-2-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)oxy]furan-2-carbonyl]amino]prop-2-enylidene]vanadium |
|---|---|
| PubChem CID | 166167986 |
| Molecular Formula | C26H32N2O5VW-2 |
| Molecular Weight | 687.34 g/mol |
| Exact Mass | 687.13 |
| IUPAC Name | aminomethylidenetungsten;[1,3-dimethoxy-2-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)oxy]furan-2-carbonyl]amino]prop-2-enylidene]vanadium |
| SMILES | CO/[C-]=C(\NC(=O)c1ccc(Oc2cc3c(cc2C)C(C)(C)CCC3(C)C)o1)C(=[V])OC.N[C-]=[W] |
| InChI | InChI=1S/C25H30NO5.CH2N.V.W/c1-16-12-18-19(25(4,5)11-10-24(18,2)3)13-21(16)31-22-9-8-20(30-22)23(27)26-17(14-28-6)15-29-7;1-2;;/h8-9,12-13H,10-11H2,1-7H3,(H,26,27);2H2;;/q2*-1;; |
| InChIKey | DMAQXMDYLXAEFS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|