C26H34N2O5VW-2 — CID 166167870
[1,3-dimethoxy-2-[[5-[(3,3,6-trimethyl-1,2-dihydroinden-5-yl)oxy]furan-2-carbonyl]amino]prop-2-enylidene]vanadium;ethane;methylaminomethylidenetungsten (PubChem CID 166167870) has the molecular formula C26H34N2O5VW-2 and a molecular weight of 689.35 g/mol. Its IUPAC name is [1,3-dimethoxy-2-[[5-[(3,3,6-trimethyl-1,2-dihydroinden-5-yl)oxy]furan-2-carbonyl]amino]prop-2-enylidene]vanadium;ethane;methylaminomethylidenetungsten.
| Compound Name | [1,3-dimethoxy-2-[[5-[(3,3,6-trimethyl-1,2-dihydroinden-5-yl)oxy]furan-2-carbonyl]amino]prop-2-enylidene]vanadium;ethane;methylaminomethylidenetungsten |
|---|---|
| PubChem CID | 166167870 |
| Molecular Formula | C26H34N2O5VW-2 |
| Molecular Weight | 689.35 g/mol |
| Exact Mass | 689.14 |
| IUPAC Name | [1,3-dimethoxy-2-[[5-[(3,3,6-trimethyl-1,2-dihydroinden-5-yl)oxy]furan-2-carbonyl]amino]prop-2-enylidene]vanadium;ethane;methylaminomethylidenetungsten |
| SMILES | CC.CN[C-]=[W].CO/[C-]=C(\NC(=O)c1ccc(Oc2cc3c(cc2C)CCC3(C)C)o1)C(=[V])OC |
| InChI | InChI=1S/C22H24NO5.C2H4N.C2H6.V.W/c1-14-10-15-8-9-22(2,3)17(15)11-19(14)28-20-7-6-18(27-20)21(24)23-16(12-25-4)13-26-5;1-3-2;1-2;;/h6-7,10-11H,8-9H2,1-5H3,(H,23,24);3H,1H3;1-2H3;;/q2*-1;;; |
| InChIKey | YMXYYIZAJROQMS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|