C29H35N3O3 — CID 21047085
N-(2,3-dihydro-1H-benzimidazol-2-ylmethyl)-5-[(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21047085) has the molecular formula C29H35N3O3 and a molecular weight of 473.62 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-benzimidazol-2-ylmethyl)-5-[(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-(2,3-dihydro-1H-benzimidazol-2-ylmethyl)-5-[(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047085 |
| Molecular Formula | C29H35N3O3 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | N-(2,3-dihydro-1H-benzimidazol-2-ylmethyl)-5-[(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | COc1cc2c(cc1Cc1ccc(C(=O)NCC3Nc4ccccc4N3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C29H35N3O3/c1-28(2)12-13-29(3,4)21-16-25(34-5)18(15-20(21)28)14-19-10-11-24(35-19)27(33)30-17-26-31-22-8-6-7-9-23(22)32-26/h6-11,15-16,26,31-32H,12-14,17H2,1-5H3,(H,30,33) |
| InChIKey | YPBYRTGPLLDZKJ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 75.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |