C19H21F3N2O3 — CID 86845813
1-[(3-methylphenyl)methyl]-2-oxo-N-[3-(2,2,2-trifluoroethoxy)propyl]pyridine-3-carboxamide (PubChem CID 86845813) has the molecular formula C19H21F3N2O3 and a molecular weight of 382.38 g/mol. Its IUPAC name is 1-[(3-methylphenyl)methyl]-2-oxo-N-[3-(2,2,2-trifluoroethoxy)propyl]pyridine-3-carboxamide.
| Compound Name | 1-[(3-methylphenyl)methyl]-2-oxo-N-[3-(2,2,2-trifluoroethoxy)propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 86845813 |
| Molecular Formula | C19H21F3N2O3 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-[(3-methylphenyl)methyl]-2-oxo-N-[3-(2,2,2-trifluoroethoxy)propyl]pyridine-3-carboxamide |
| SMILES | Cc1cccc(Cn2cccc(C(=O)NCCCOCC(F)(F)F)c2=O)c1 |
| InChI | InChI=1S/C19H21F3N2O3/c1-14-5-2-6-15(11-14)12-24-9-3-7-16(18(24)26)17(25)23-8-4-10-27-13-19(20,21)22/h2-3,5-7,9,11H,4,8,10,12-13H2,1H3,(H,23,25) |
| InChIKey | AMEYSXQQOWMXQY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|