C23H30ClN3O4 — CID 59362456
tert-butyl N-[5-[[1-[(3-chlorophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]pentyl]carbamate (PubChem CID 59362456) has the molecular formula C23H30ClN3O4 and a molecular weight of 447.96 g/mol. Its IUPAC name is tert-butyl N-[5-[[1-[(3-chlorophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[[1-[(3-chlorophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]pentyl]carbamate |
|---|---|
| PubChem CID | 59362456 |
| Molecular Formula | C23H30ClN3O4 |
| Molecular Weight | 447.96 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | tert-butyl N-[5-[[1-[(3-chlorophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCNC(=O)c1cccn(Cc2cccc(Cl)c2)c1=O |
| InChI | InChI=1S/C23H30ClN3O4/c1-23(2,3)31-22(30)26-13-6-4-5-12-25-20(28)19-11-8-14-27(21(19)29)16-17-9-7-10-18(24)15-17/h7-11,14-15H,4-6,12-13,16H2,1-3H3,(H,25,28)(H,26,30) |
| InChIKey | UVEXADZLFCWFKM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.96 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|