C19H21Cl2NOS — CID 100600308
3-(2,6-dichlorophenyl)-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]propanamide (PubChem CID 100600308) has the molecular formula C19H21Cl2NOS and a molecular weight of 382.36 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]propanamide.
| Compound Name | 3-(2,6-dichlorophenyl)-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]propanamide |
|---|---|
| PubChem CID | 100600308 |
| Molecular Formula | C19H21Cl2NOS |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]propanamide |
| SMILES | Cc1cccc(CSCCNC(=O)CCc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C19H21Cl2NOS/c1-14-4-2-5-15(12-14)13-24-11-10-22-19(23)9-8-16-17(20)6-3-7-18(16)21/h2-7,12H,8-11,13H2,1H3,(H,22,23) |
| InChIKey | XIICFHCKJZWIJQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|