C26H30N2O3S2 — CID 126414743
3-[(3,4-dimethylphenyl)sulfamoyl]-4-methyl-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]benzamide (PubChem CID 126414743) has the molecular formula C26H30N2O3S2 and a molecular weight of 482.67 g/mol. Its IUPAC name is 3-[(3,4-dimethylphenyl)sulfamoyl]-4-methyl-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]benzamide.
| Compound Name | 3-[(3,4-dimethylphenyl)sulfamoyl]-4-methyl-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 126414743 |
| Molecular Formula | C26H30N2O3S2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 3-[(3,4-dimethylphenyl)sulfamoyl]-4-methyl-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]benzamide |
| SMILES | Cc1ccc(CSCCNC(=O)c2ccc(C)c(S(=O)(=O)Nc3ccc(C)c(C)c3)c2)cc1 |
| InChI | InChI=1S/C26H30N2O3S2/c1-18-5-9-22(10-6-18)17-32-14-13-27-26(29)23-11-7-20(3)25(16-23)33(30,31)28-24-12-8-19(2)21(4)15-24/h5-12,15-16,28H,13-14,17H2,1-4H3,(H,27,29) |
| InChIKey | WMEMEUIRRVZASZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|