C25H27ClN2O3S2 — CID 3469955
N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-3-[(2,5-dimethylphenyl)sulfamoyl]-4-methylbenzamide (PubChem CID 3469955) has the molecular formula C25H27ClN2O3S2 and a molecular weight of 503.09 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-3-[(2,5-dimethylphenyl)sulfamoyl]-4-methylbenzamide.
| Compound Name | N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-3-[(2,5-dimethylphenyl)sulfamoyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 3469955 |
| Molecular Formula | C25H27ClN2O3S2 |
| Molecular Weight | 503.09 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-3-[(2,5-dimethylphenyl)sulfamoyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C)c(NS(=O)(=O)c2cc(C(=O)NCCSCc3cccc(Cl)c3)ccc2C)c1 |
| InChI | InChI=1S/C25H27ClN2O3S2/c1-17-7-8-18(2)23(13-17)28-33(30,31)24-15-21(10-9-19(24)3)25(29)27-11-12-32-16-20-5-4-6-22(26)14-20/h4-10,13-15,28H,11-12,16H2,1-3H3,(H,27,29) |
| InChIKey | UECBQWCBYGJJBA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.09 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|