C25H26Cl2N2O3S2 — CID 126415670
N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-3-[(2,3-dimethylphenyl)sulfamoyl]-4-methylbenzamide (PubChem CID 126415670) has the molecular formula C25H26Cl2N2O3S2 and a molecular weight of 537.53 g/mol. Its IUPAC name is N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-3-[(2,3-dimethylphenyl)sulfamoyl]-4-methylbenzamide.
| Compound Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-3-[(2,3-dimethylphenyl)sulfamoyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 126415670 |
| Molecular Formula | C25H26Cl2N2O3S2 |
| Molecular Weight | 537.53 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-3-[(2,3-dimethylphenyl)sulfamoyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCSCc2c(Cl)cccc2Cl)cc1S(=O)(=O)Nc1cccc(C)c1C |
| InChI | InChI=1S/C25H26Cl2N2O3S2/c1-16-6-4-9-23(18(16)3)29-34(31,32)24-14-19(11-10-17(24)2)25(30)28-12-13-33-15-20-21(26)7-5-8-22(20)27/h4-11,14,29H,12-13,15H2,1-3H3,(H,28,30) |
| InChIKey | GDFQZZSIDFWPSV-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.53 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|