C17H17Cl3N2O3S2 — CID 43909164
2-chloro-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-5-(methanesulfonamido)benzamide (PubChem CID 43909164) has the molecular formula C17H17Cl3N2O3S2 and a molecular weight of 467.83 g/mol. Its IUPAC name is 2-chloro-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-5-(methanesulfonamido)benzamide.
| Compound Name | 2-chloro-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-5-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 43909164 |
| Molecular Formula | C17H17Cl3N2O3S2 |
| Molecular Weight | 467.83 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | 2-chloro-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-5-(methanesulfonamido)benzamide |
| SMILES | CS(=O)(=O)Nc1ccc(Cl)c(C(=O)NCCSCc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C17H17Cl3N2O3S2/c1-27(24,25)22-11-5-6-16(20)12(9-11)17(23)21-7-8-26-10-13-14(18)3-2-4-15(13)19/h2-6,9,22H,7-8,10H2,1H3,(H,21,23) |
| InChIKey | CFYYXLIYFMRJAA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.83 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|