C17H18ClFN2O3S — CID 28635620
2-chloro-N-[3-(4-fluorophenyl)propyl]-5-(methanesulfonamido)benzamide (PubChem CID 28635620) has the molecular formula C17H18ClFN2O3S and a molecular weight of 384.86 g/mol. Its IUPAC name is 2-chloro-N-[3-(4-fluorophenyl)propyl]-5-(methanesulfonamido)benzamide.
| Compound Name | 2-chloro-N-[3-(4-fluorophenyl)propyl]-5-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 28635620 |
| Molecular Formula | C17H18ClFN2O3S |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 2-chloro-N-[3-(4-fluorophenyl)propyl]-5-(methanesulfonamido)benzamide |
| SMILES | CS(=O)(=O)Nc1ccc(Cl)c(C(=O)NCCCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H18ClFN2O3S/c1-25(23,24)21-14-8-9-16(18)15(11-14)17(22)20-10-2-3-12-4-6-13(19)7-5-12/h4-9,11,21H,2-3,10H2,1H3,(H,20,22) |
| InChIKey | BTVQNEDWTICZQJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|