C20H30N2O3S2 — CID 100750646
N-(2-cyclopentylsulfanylethyl)-3-(4-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 100750646) has the molecular formula C20H30N2O3S2 and a molecular weight of 410.61 g/mol. Its IUPAC name is N-(2-cyclopentylsulfanylethyl)-3-(4-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-(2-cyclopentylsulfanylethyl)-3-(4-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 100750646 |
| Molecular Formula | C20H30N2O3S2 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | N-(2-cyclopentylsulfanylethyl)-3-(4-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CC1CCN(S(=O)(=O)c2cccc(C(=O)NCCSC3CCCC3)c2)CC1 |
| InChI | InChI=1S/C20H30N2O3S2/c1-16-9-12-22(13-10-16)27(24,25)19-8-4-5-17(15-19)20(23)21-11-14-26-18-6-2-3-7-18/h4-5,8,15-16,18H,2-3,6-7,9-14H2,1H3,(H,21,23) |
| InChIKey | YTJDKSFGXRBFRK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|