C26H27N3O2 — CID 52667442
4-(3,3-diphenylpropylcarbamoylamino)-N-prop-2-enylbenzamide (PubChem CID 52667442) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 4-(3,3-diphenylpropylcarbamoylamino)-N-prop-2-enylbenzamide.
| Compound Name | 4-(3,3-diphenylpropylcarbamoylamino)-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 52667442 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 4-(3,3-diphenylpropylcarbamoylamino)-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccc(NC(=O)NCCC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H27N3O2/c1-2-18-27-25(30)22-13-15-23(16-14-22)29-26(31)28-19-17-24(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h2-16,24H,1,17-19H2,(H,27,30)(H2,28,29,31) |
| InChIKey | ZXRZGBFCMANSSX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|