bis(3-benzamidopropanoic acid);piperazine

C24H32N4O6 — CID 3045072

IUPACbis(3-benzamidopropanoic acid);piperazine
SMILESC1CNCCN1.O=C(O)CCNC(=O)c1ccccc1.O=C(O)CCNC(=O)c1ccccc1
InChIInChI=1S/2C10H11NO3.C4H10N2/c2*12-9(13)6-7-11-10(14)8-4-2-1-3-5-8;1-2-6-4-3-5-1/h2*1-5H,6-7H2,(H,11,14)(H,12,13);5-6H,1-4H2
InChIKeyFUAIYZQUQFFHRP-UHFFFAOYSA-N
MW472.54 g/mol
LogP0.96
Rot. Bonds8

About bis(3-benzamidopropanoic acid);piperazine

bis(3-benzamidopropanoic acid);piperazine (PubChem CID 3045072) has the molecular formula C24H32N4O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is bis(3-benzamidopropanoic acid);piperazine.

Molecular Properties

Compound Namebis(3-benzamidopropanoic acid);piperazine
PubChem CID3045072
Molecular FormulaC24H32N4O6
Molecular Weight472.54 g/mol
Exact Mass472.23
IUPAC Namebis(3-benzamidopropanoic acid);piperazine
SMILESC1CNCCN1.O=C(O)CCNC(=O)c1ccccc1.O=C(O)CCNC(=O)c1ccccc1
InChIInChI=1S/2C10H11NO3.C4H10N2/c2*12-9(13)6-7-11-10(14)8-4-2-1-3-5-8;1-2-6-4-3-5-1/h2*1-5H,6-7H2,(H,11,14)(H,12,13);5-6H,1-4H2
InChIKeyFUAIYZQUQFFHRP-UHFFFAOYSA-N
XLogP0.96
TPSA156.86 Ų
H-Bond Donors6
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms34
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500472.54
LogP ≤ 50.96
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 106

Analyze bis(3-benzamidopropanoic acid);piperazine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(3-benzamidopropanoic acid);piperazine?
The IUPAC name of bis(3-benzamidopropanoic acid);piperazine (CID 3045072) is bis(3-benzamidopropanoic acid);piperazine.
What is the SMILES notation for bis(3-benzamidopropanoic acid);piperazine?
The canonical SMILES for bis(3-benzamidopropanoic acid);piperazine is C1CNCCN1.O=C(O)CCNC(=O)c1ccccc1.O=C(O)CCNC(=O)c1ccccc1.
What is the InChIKey of bis(3-benzamidopropanoic acid);piperazine?
The InChIKey is FUAIYZQUQFFHRP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H11NO3.C4H10N2/c2*12-9(13)6-7-11-10(14)8-4-2-1-3-5-8;1-2-6-4-3-5-1/h2*1-5H,6-7H2,(H,11,14)(H,12,13);5-6H,1-4H2.
What are the key properties of bis(3-benzamidopropanoic acid);piperazine?
bis(3-benzamidopropanoic acid);piperazine has a molecular weight of 472.54 g/mol, XLogP of 0.96, 8 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-benzamidopropanoic acid);piperazine is sourced from PubChem (CID 3045072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).