C24H32N4O6 — CID 3045072
bis(3-benzamidopropanoic acid);piperazine (PubChem CID 3045072) has the molecular formula C24H32N4O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is bis(3-benzamidopropanoic acid);piperazine.
| Compound Name | bis(3-benzamidopropanoic acid);piperazine |
|---|---|
| PubChem CID | 3045072 |
| Molecular Formula | C24H32N4O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | bis(3-benzamidopropanoic acid);piperazine |
| SMILES | C1CNCCN1.O=C(O)CCNC(=O)c1ccccc1.O=C(O)CCNC(=O)c1ccccc1 |
| InChI | InChI=1S/2C10H11NO3.C4H10N2/c2*12-9(13)6-7-11-10(14)8-4-2-1-3-5-8;1-2-6-4-3-5-1/h2*1-5H,6-7H2,(H,11,14)(H,12,13);5-6H,1-4H2 |
| InChIKey | FUAIYZQUQFFHRP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |