C16H22NO8P — CID 89085883
2-[[[[(2S)-4-carboxy-1-oxobutan-2-yl]amino]-hydroxyphosphoryl]oxymethyl]-4-phenylbutanoic acid (PubChem CID 89085883) has the molecular formula C16H22NO8P and a molecular weight of 387.33 g/mol. Its IUPAC name is 2-[[[[(2S)-4-carboxy-1-oxobutan-2-yl]amino]-hydroxyphosphoryl]oxymethyl]-4-phenylbutanoic acid.
| Compound Name | 2-[[[[(2S)-4-carboxy-1-oxobutan-2-yl]amino]-hydroxyphosphoryl]oxymethyl]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 89085883 |
| Molecular Formula | C16H22NO8P |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2-[[[[(2S)-4-carboxy-1-oxobutan-2-yl]amino]-hydroxyphosphoryl]oxymethyl]-4-phenylbutanoic acid |
| SMILES | O=C[C@H](CCC(=O)O)NP(=O)(O)OCC(CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H22NO8P/c18-10-14(8-9-15(19)20)17-26(23,24)25-11-13(16(21)22)7-6-12-4-2-1-3-5-12/h1-5,10,13-14H,6-9,11H2,(H,19,20)(H,21,22)(H2,17,23,24)/t13?,14-/m0/s1 |
| InChIKey | OPUXGPNZXIVKAO-KZUDCZAMSA-N |
| XLogP | 1.46 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|