C15H18N2O6 — CID 89250867
4-[[(1S)-1-carboxy-2-phenylethyl]carbamoylamino]-5-oxopentanoic acid (PubChem CID 89250867) has the molecular formula C15H18N2O6 and a molecular weight of 322.32 g/mol. Its IUPAC name is 4-[[(1S)-1-carboxy-2-phenylethyl]carbamoylamino]-5-oxopentanoic acid.
| Compound Name | 4-[[(1S)-1-carboxy-2-phenylethyl]carbamoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 89250867 |
| Molecular Formula | C15H18N2O6 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 4-[[(1S)-1-carboxy-2-phenylethyl]carbamoylamino]-5-oxopentanoic acid |
| SMILES | O=CC(CCC(=O)O)NC(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H18N2O6/c18-9-11(6-7-13(19)20)16-15(23)17-12(14(21)22)8-10-4-2-1-3-5-10/h1-5,9,11-12H,6-8H2,(H,19,20)(H,21,22)(H2,16,17,23)/t11?,12-/m0/s1 |
| InChIKey | YUQJMWIYTNGIJB-KIYNQFGBSA-N |
| XLogP | 0.41 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|