C9H15O7P — CID 123658144
2-[[2-carboxyethyl(hydroxy)phosphanyl]methyl]pentanedioic acid (PubChem CID 123658144) has the molecular formula C9H15O7P and a molecular weight of 266.19 g/mol. Its IUPAC name is 2-[[2-carboxyethyl(hydroxy)phosphanyl]methyl]pentanedioic acid.
| Compound Name | 2-[[2-carboxyethyl(hydroxy)phosphanyl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 123658144 |
| Molecular Formula | C9H15O7P |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-[[2-carboxyethyl(hydroxy)phosphanyl]methyl]pentanedioic acid |
| SMILES | O=C(O)CCC(CP(O)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H15O7P/c10-7(11)2-1-6(9(14)15)5-17(16)4-3-8(12)13/h6,16H,1-5H2,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | CKINSXRCGLRHTM-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|