C16H26O8S2 — CID 11069608
2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid (PubChem CID 11069608) has the molecular formula C16H26O8S2 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid.
| Compound Name | 2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid |
|---|---|
| PubChem CID | 11069608 |
| Molecular Formula | C16H26O8S2 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid |
| SMILES | O=C(O)CCC(CCCSSCCCC(CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H26O8S2/c17-13(18)7-5-11(15(21)22)3-1-9-25-26-10-2-4-12(16(23)24)6-8-14(19)20/h11-12H,1-10H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | FWXRWGOZASTQKI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|