2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid

C16H26O8S2 — CID 11069608

IUPAC2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid
SMILESO=C(O)CCC(CCCSSCCCC(CCC(=O)O)C(=O)O)C(=O)O
InChIInChI=1S/C16H26O8S2/c17-13(18)7-5-11(15(21)22)3-1-9-25-26-10-2-4-12(16(23)24)6-8-14(19)20/h11-12H,1-10H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24)
InChIKeyFWXRWGOZASTQKI-UHFFFAOYSA-N
MW410.51 g/mol
LogP3.06
Rot. Bonds17

About 2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid

2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid (PubChem CID 11069608) has the molecular formula C16H26O8S2 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid.

Molecular Properties

Compound Name2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid
PubChem CID11069608
Molecular FormulaC16H26O8S2
Molecular Weight410.51 g/mol
Exact Mass410.11
IUPAC Name2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid
SMILESO=C(O)CCC(CCCSSCCCC(CCC(=O)O)C(=O)O)C(=O)O
InChIInChI=1S/C16H26O8S2/c17-13(18)7-5-11(15(21)22)3-1-9-25-26-10-2-4-12(16(23)24)6-8-14(19)20/h11-12H,1-10H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24)
InChIKeyFWXRWGOZASTQKI-UHFFFAOYSA-N
XLogP3.06
TPSA149.20 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds17
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500410.51
LogP ≤ 53.06
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}

Analyze 2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid?
The IUPAC name of 2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid (CID 11069608) is 2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid.
What is the SMILES notation for 2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid?
The canonical SMILES for 2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid is O=C(O)CCC(CCCSSCCCC(CCC(=O)O)C(=O)O)C(=O)O.
What is the InChIKey of 2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid?
The InChIKey is FWXRWGOZASTQKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O8S2/c17-13(18)7-5-11(15(21)22)3-1-9-25-26-10-2-4-12(16(23)24)6-8-14(19)20/h11-12H,1-10H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24).
What are the key properties of 2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid?
2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid has a molecular weight of 410.51 g/mol, XLogP of 3.06, 17 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4,6-dicarboxyhexyldisulfanyl)propyl]pentanedioic acid is sourced from PubChem (CID 11069608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).