C8H16NO5P — CID 141452826
(2S)-2-[[hydroxy(propyl)phosphanyl]amino]pentanedioic acid (PubChem CID 141452826) has the molecular formula C8H16NO5P and a molecular weight of 237.19 g/mol. Its IUPAC name is (2S)-2-[[hydroxy(propyl)phosphanyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[hydroxy(propyl)phosphanyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 141452826 |
| Molecular Formula | C8H16NO5P |
| Molecular Weight | 237.19 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (2S)-2-[[hydroxy(propyl)phosphanyl]amino]pentanedioic acid |
| SMILES | CCCP(O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H16NO5P/c1-2-5-15(14)9-6(8(12)13)3-4-7(10)11/h6,9,14H,2-5H2,1H3,(H,10,11)(H,12,13)/t6-,15?/m0/s1 |
| InChIKey | XIRMSEBZYQVMNB-DJMHDKPGSA-N |
| XLogP | 0.61 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.19 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|