C15H25NO6P+ — CID 174407866
benzene;butane;(1,3-dicarboxypropylamino)-hydroxy-oxophosphanium (PubChem CID 174407866) has the molecular formula C15H25NO6P+ and a molecular weight of 346.34 g/mol. Its IUPAC name is benzene;butane;(1,3-dicarboxypropylamino)-hydroxy-oxophosphanium.
| Compound Name | benzene;butane;(1,3-dicarboxypropylamino)-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 174407866 |
| Molecular Formula | C15H25NO6P+ |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | benzene;butane;(1,3-dicarboxypropylamino)-hydroxy-oxophosphanium |
| SMILES | CCCC.O=C(O)CCC(N[P+](=O)O)C(=O)O.c1ccccc1 |
| InChI | InChI=1S/C6H6.C5H8NO6P.C4H10/c1-2-4-6-5-3-1;7-4(8)2-1-3(5(9)10)6-13(11)12;1-3-4-2/h1-6H;3H,1-2H2,(H3-,6,7,8,9,10,11,12);3-4H2,1-2H3/p+1 |
| InChIKey | OFACYLMQEXMGGE-UHFFFAOYSA-O |
| XLogP | 3.04 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|