C12H22N2O7PS+ — CID 122593478
[[(1R)-2-tert-butylsulfanyl-1-carboxyethyl]amino]-[[(1S)-1,3-dicarboxypropyl]amino]-oxophosphanium (PubChem CID 122593478) has the molecular formula C12H22N2O7PS+ and a molecular weight of 369.36 g/mol. Its IUPAC name is [[(1R)-2-tert-butylsulfanyl-1-carboxyethyl]amino]-[[(1S)-1,3-dicarboxypropyl]amino]-oxophosphanium.
| Compound Name | [[(1R)-2-tert-butylsulfanyl-1-carboxyethyl]amino]-[[(1S)-1,3-dicarboxypropyl]amino]-oxophosphanium |
|---|---|
| PubChem CID | 122593478 |
| Molecular Formula | C12H22N2O7PS+ |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | [[(1R)-2-tert-butylsulfanyl-1-carboxyethyl]amino]-[[(1S)-1,3-dicarboxypropyl]amino]-oxophosphanium |
| SMILES | CC(C)(C)SC[C@H](N[P+](=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H21N2O7PS/c1-12(2,3)23-6-8(11(19)20)14-22(21)13-7(10(17)18)4-5-9(15)16/h7-8H,4-6H2,1-3H3,(H4-,13,14,15,16,17,18,19,20,21)/p+1/t7-,8-/m0/s1 |
| InChIKey | QKGJAUAKZZKRIH-YUMQZZPRSA-O |
| XLogP | 1.13 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|