C12H22N2O5 — CID 114174501
(2S)-2-(3-methylpentan-3-ylcarbamoylamino)pentanedioic acid (PubChem CID 114174501) has the molecular formula C12H22N2O5 and a molecular weight of 274.32 g/mol. Its IUPAC name is (2S)-2-(3-methylpentan-3-ylcarbamoylamino)pentanedioic acid.
| Compound Name | (2S)-2-(3-methylpentan-3-ylcarbamoylamino)pentanedioic acid |
|---|---|
| PubChem CID | 114174501 |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | (2S)-2-(3-methylpentan-3-ylcarbamoylamino)pentanedioic acid |
| SMILES | CCC(C)(CC)NC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H22N2O5/c1-4-12(3,5-2)14-11(19)13-8(10(17)18)6-7-9(15)16/h8H,4-7H2,1-3H3,(H,15,16)(H,17,18)(H2,13,14,19)/t8-/m0/s1 |
| InChIKey | PXYVWYUWJILQQG-QMMMGPOBSA-N |
| XLogP | 1.18 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |