C12H18N4O2 — CID 66644748
(4R)-4-amino-5-[4-(diaminomethylideneamino)phenyl]pentanoic acid (PubChem CID 66644748) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is (4R)-4-amino-5-[4-(diaminomethylideneamino)phenyl]pentanoic acid.
| Compound Name | (4R)-4-amino-5-[4-(diaminomethylideneamino)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 66644748 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (4R)-4-amino-5-[4-(diaminomethylideneamino)phenyl]pentanoic acid |
| SMILES | NC(N)=Nc1ccc(C[C@H](N)CCC(=O)O)cc1 |
| InChI | InChI=1S/C12H18N4O2/c13-9(3-6-11(17)18)7-8-1-4-10(5-2-8)16-12(14)15/h1-2,4-5,9H,3,6-7,13H2,(H,17,18)(H4,14,15,16)/t9-/m1/s1 |
| InChIKey | XHWBASXXPSNREM-SECBINFHSA-N |
| XLogP | 0.33 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|