C13H17N3O2 — CID 117370535
4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid (PubChem CID 117370535) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid.
| Compound Name | 4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 117370535 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid |
| SMILES | NC(CCC(=O)O)c1ccc(N2C=NCC2)cc1 |
| InChI | InChI=1S/C13H17N3O2/c14-12(5-6-13(17)18)10-1-3-11(4-2-10)16-8-7-15-9-16/h1-4,9,12H,5-8,14H2,(H,17,18) |
| InChIKey | MKKRUYNXOYDVFP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|