4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid

C13H17N3O2 — CID 117370535

IUPAC4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid
SMILESNC(CCC(=O)O)c1ccc(N2C=NCC2)cc1
InChIInChI=1S/C13H17N3O2/c14-12(5-6-13(17)18)10-1-3-11(4-2-10)16-8-7-15-9-16/h1-4,9,12H,5-8,14H2,(H,17,18)
InChIKeyMKKRUYNXOYDVFP-UHFFFAOYSA-N
MW247.30 g/mol
LogP1.40
Rot. Bonds5

About 4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid

4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid (PubChem CID 117370535) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid.

Molecular Properties

Compound Name4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid
PubChem CID117370535
Molecular FormulaC13H17N3O2
Molecular Weight247.30 g/mol
Exact Mass247.13
IUPAC Name4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid
SMILESNC(CCC(=O)O)c1ccc(N2C=NCC2)cc1
InChIInChI=1S/C13H17N3O2/c14-12(5-6-13(17)18)10-1-3-11(4-2-10)16-8-7-15-9-16/h1-4,9,12H,5-8,14H2,(H,17,18)
InChIKeyMKKRUYNXOYDVFP-UHFFFAOYSA-N
XLogP1.40
TPSA78.92 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.30
LogP ≤ 51.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}

Analyze 4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid?
The IUPAC name of 4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid (CID 117370535) is 4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid.
What is the SMILES notation for 4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid?
The canonical SMILES for 4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid is NC(CCC(=O)O)c1ccc(N2C=NCC2)cc1.
What is the InChIKey of 4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid?
The InChIKey is MKKRUYNXOYDVFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O2/c14-12(5-6-13(17)18)10-1-3-11(4-2-10)16-8-7-15-9-16/h1-4,9,12H,5-8,14H2,(H,17,18).
What are the key properties of 4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid?
4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid has a molecular weight of 247.30 g/mol, XLogP of 1.40, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butanoic acid is sourced from PubChem (CID 117370535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).