C28H40N2O2 — CID 21241505
1-[4-(4-benzylpiperazin-1-yl)-1-(4-methoxyphenyl)butyl]cyclohexan-1-ol (PubChem CID 21241505) has the molecular formula C28H40N2O2 and a molecular weight of 436.64 g/mol. Its IUPAC name is 1-[4-(4-benzylpiperazin-1-yl)-1-(4-methoxyphenyl)butyl]cyclohexan-1-ol.
| Compound Name | 1-[4-(4-benzylpiperazin-1-yl)-1-(4-methoxyphenyl)butyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 21241505 |
| Molecular Formula | C28H40N2O2 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.31 |
| IUPAC Name | 1-[4-(4-benzylpiperazin-1-yl)-1-(4-methoxyphenyl)butyl]cyclohexan-1-ol |
| SMILES | COc1ccc(C(CCCN2CCN(Cc3ccccc3)CC2)C2(O)CCCCC2)cc1 |
| InChI | InChI=1S/C28H40N2O2/c1-32-26-14-12-25(13-15-26)27(28(31)16-6-3-7-17-28)11-8-18-29-19-21-30(22-20-29)23-24-9-4-2-5-10-24/h2,4-5,9-10,12-15,27,31H,3,6-8,11,16-23H2,1H3 |
| InChIKey | UZVLDDPJRHGAKJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |