C23H29NO3 — CID 14974102
benzyl N-[1-(1-hydroxycyclohexyl)-3-phenylpropyl]carbamate (PubChem CID 14974102) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is benzyl N-[1-(1-hydroxycyclohexyl)-3-phenylpropyl]carbamate.
| Compound Name | benzyl N-[1-(1-hydroxycyclohexyl)-3-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 14974102 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | benzyl N-[1-(1-hydroxycyclohexyl)-3-phenylpropyl]carbamate |
| SMILES | O=C(NC(CCc1ccccc1)C1(O)CCCCC1)OCc1ccccc1 |
| InChI | InChI=1S/C23H29NO3/c25-22(27-18-20-12-6-2-7-13-20)24-21(23(26)16-8-3-9-17-23)15-14-19-10-4-1-5-11-19/h1-2,4-7,10-13,21,26H,3,8-9,14-18H2,(H,24,25) |
| InChIKey | HPNOZXHKEMSEEG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |