C19H21NO5 — CID 57026651
benzyl N-[(1R)-1-[(2S)-3,3-dihydroxyoxiran-2-yl]-3-phenylpropyl]carbamate (PubChem CID 57026651) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is benzyl N-[(1R)-1-[(2S)-3,3-dihydroxyoxiran-2-yl]-3-phenylpropyl]carbamate.
| Compound Name | benzyl N-[(1R)-1-[(2S)-3,3-dihydroxyoxiran-2-yl]-3-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 57026651 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | benzyl N-[(1R)-1-[(2S)-3,3-dihydroxyoxiran-2-yl]-3-phenylpropyl]carbamate |
| SMILES | O=C(N[C@H](CCc1ccccc1)[C@@H]1OC1(O)O)OCc1ccccc1 |
| InChI | InChI=1S/C19H21NO5/c21-18(24-13-15-9-5-2-6-10-15)20-16(17-19(22,23)25-17)12-11-14-7-3-1-4-8-14/h1-10,16-17,22-23H,11-13H2,(H,20,21)/t16-,17+/m1/s1 |
| InChIKey | CIVHDHNOPXRTDS-SJORKVTESA-N |
| XLogP | 1.95 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|