C23H36N2O4 — CID 154061271
butyl 4-[2-(1-hydroxycyclohexyl)-2-(4-hydroxyphenyl)ethyl]piperazine-1-carboxylate (PubChem CID 154061271) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is butyl 4-[2-(1-hydroxycyclohexyl)-2-(4-hydroxyphenyl)ethyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[2-(1-hydroxycyclohexyl)-2-(4-hydroxyphenyl)ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 154061271 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | butyl 4-[2-(1-hydroxycyclohexyl)-2-(4-hydroxyphenyl)ethyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(CC(c2ccc(O)cc2)C2(O)CCCCC2)CC1 |
| InChI | InChI=1S/C23H36N2O4/c1-2-3-17-29-22(27)25-15-13-24(14-16-25)18-21(19-7-9-20(26)10-8-19)23(28)11-5-4-6-12-23/h7-10,21,26,28H,2-6,11-18H2,1H3 |
| InChIKey | LNJJPGXAKUTLNO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|