C28H36N2O5 — CID 154061296
butyl 4-[2-(1-hydroxycyclobutyl)-2-(4-phenylmethoxyphenyl)acetyl]piperazine-1-carboxylate (PubChem CID 154061296) has the molecular formula C28H36N2O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is butyl 4-[2-(1-hydroxycyclobutyl)-2-(4-phenylmethoxyphenyl)acetyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[2-(1-hydroxycyclobutyl)-2-(4-phenylmethoxyphenyl)acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 154061296 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | butyl 4-[2-(1-hydroxycyclobutyl)-2-(4-phenylmethoxyphenyl)acetyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(C(=O)C(c2ccc(OCc3ccccc3)cc2)C2(O)CCC2)CC1 |
| InChI | InChI=1S/C28H36N2O5/c1-2-3-20-34-27(32)30-18-16-29(17-19-30)26(31)25(28(33)14-7-15-28)23-10-12-24(13-11-23)35-21-22-8-5-4-6-9-22/h4-6,8-13,25,33H,2-3,7,14-21H2,1H3 |
| InChIKey | UMJHFLXQBMUHFE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|