C18H24FNO — CID 110436863
azepan-1-yl-[1-(2-fluorophenyl)cyclopentyl]methanone (PubChem CID 110436863) has the molecular formula C18H24FNO and a molecular weight of 289.39 g/mol. Its IUPAC name is azepan-1-yl-[1-(2-fluorophenyl)cyclopentyl]methanone.
| Compound Name | azepan-1-yl-[1-(2-fluorophenyl)cyclopentyl]methanone |
|---|---|
| PubChem CID | 110436863 |
| Molecular Formula | C18H24FNO |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | azepan-1-yl-[1-(2-fluorophenyl)cyclopentyl]methanone |
| SMILES | O=C(N1CCCCCC1)C1(c2ccccc2F)CCCC1 |
| InChI | InChI=1S/C18H24FNO/c19-16-10-4-3-9-15(16)18(11-5-6-12-18)17(21)20-13-7-1-2-8-14-20/h3-4,9-10H,1-2,5-8,11-14H2 |
| InChIKey | ILOOSFICMURURB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |