C17H21FN2O2 — CID 110436587
1-[1-(2-fluorophenyl)cyclobutanecarbonyl]piperidine-4-carboxamide (PubChem CID 110436587) has the molecular formula C17H21FN2O2 and a molecular weight of 304.36 g/mol. Its IUPAC name is 1-[1-(2-fluorophenyl)cyclobutanecarbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[1-(2-fluorophenyl)cyclobutanecarbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110436587 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 1-[1-(2-fluorophenyl)cyclobutanecarbonyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)C2(c3ccccc3F)CCC2)CC1 |
| InChI | InChI=1S/C17H21FN2O2/c18-14-5-2-1-4-13(14)17(8-3-9-17)16(22)20-10-6-12(7-11-20)15(19)21/h1-2,4-5,12H,3,6-11H2,(H2,19,21) |
| InChIKey | BLOZMTXLXXSSSE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |