C33H34N2O4 — CID 66807728
N,N'-bis[(S)-(1-hydroxycyclobutyl)-naphthalen-1-ylmethyl]propanediamide (PubChem CID 66807728) has the molecular formula C33H34N2O4 and a molecular weight of 522.65 g/mol. Its IUPAC name is N,N'-bis[(S)-(1-hydroxycyclobutyl)-naphthalen-1-ylmethyl]propanediamide.
| Compound Name | N,N'-bis[(S)-(1-hydroxycyclobutyl)-naphthalen-1-ylmethyl]propanediamide |
|---|---|
| PubChem CID | 66807728 |
| Molecular Formula | C33H34N2O4 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | N,N'-bis[(S)-(1-hydroxycyclobutyl)-naphthalen-1-ylmethyl]propanediamide |
| SMILES | O=C(CC(=O)N[C@@H](c1cccc2ccccc12)C1(O)CCC1)N[C@@H](c1cccc2ccccc12)C1(O)CCC1 |
| InChI | InChI=1S/C33H34N2O4/c36-28(34-30(32(38)17-7-18-32)26-15-5-11-22-9-1-3-13-24(22)26)21-29(37)35-31(33(39)19-8-20-33)27-16-6-12-23-10-2-4-14-25(23)27/h1-6,9-16,30-31,38-39H,7-8,17-21H2,(H,34,36)(H,35,37)/t30-,31-/m0/s1 |
| InChIKey | RTAMQGKIPLUFHY-CONSDPRKSA-N |
| XLogP | 5.23 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|