C65H70N2O4 — CID 87160884
N,N'-bis[2-hydroxy-3-(4-methylphenyl)-2-[(4-methylphenyl)methyl]-3-naphthalen-1-ylpropyl]-2,2-dipropylpropanediamide (PubChem CID 87160884) has the molecular formula C65H70N2O4 and a molecular weight of 943.29 g/mol. Its IUPAC name is N,N'-bis[2-hydroxy-3-(4-methylphenyl)-2-[(4-methylphenyl)methyl]-3-naphthalen-1-ylpropyl]-2,2-dipropylpropanediamide.
| Compound Name | N,N'-bis[2-hydroxy-3-(4-methylphenyl)-2-[(4-methylphenyl)methyl]-3-naphthalen-1-ylpropyl]-2,2-dipropylpropanediamide |
|---|---|
| PubChem CID | 87160884 |
| Molecular Formula | C65H70N2O4 |
| Molecular Weight | 943.29 g/mol |
| Exact Mass | 942.53 |
| IUPAC Name | N,N'-bis[2-hydroxy-3-(4-methylphenyl)-2-[(4-methylphenyl)methyl]-3-naphthalen-1-ylpropyl]-2,2-dipropylpropanediamide |
| SMILES | CCCC(CCC)(C(=O)NCC(O)(Cc1ccc(C)cc1)C(c1ccc(C)cc1)c1cccc2ccccc12)C(=O)NCC(O)(Cc1ccc(C)cc1)C(c1ccc(C)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C65H70N2O4/c1-7-39-63(40-8-2,61(68)66-43-64(70,41-49-31-23-45(3)24-32-49)59(53-35-27-47(5)28-36-53)57-21-13-17-51-15-9-11-19-55(51)57)62(69)67-44-65(71,42-50-33-25-46(4)26-34-50)60(54-37-29-48(6)30-38-54)58-22-14-18-52-16-10-12-20-56(52)58/h9-38,59-60,70-71H,7-8,39-44H2,1-6H3,(H,66,68)(H,67,69) |
| InChIKey | DRDSSQVOJPTUCH-UHFFFAOYSA-N |
| XLogP | 12.96 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.29 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|