C61H60N2O4 — CID 66808006
1-N',1-N'-bis[2-hydroxy-3-(4-methylphenyl)-2-[(4-methylphenyl)methyl]-3-naphthalen-1-ylpropyl]cyclopropane-1,1-dicarboxamide (PubChem CID 66808006) has the molecular formula C61H60N2O4 and a molecular weight of 885.16 g/mol. Its IUPAC name is 1-N',1-N'-bis[2-hydroxy-3-(4-methylphenyl)-2-[(4-methylphenyl)methyl]-3-naphthalen-1-ylpropyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N',1-N'-bis[2-hydroxy-3-(4-methylphenyl)-2-[(4-methylphenyl)methyl]-3-naphthalen-1-ylpropyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66808006 |
| Molecular Formula | C61H60N2O4 |
| Molecular Weight | 885.16 g/mol |
| Exact Mass | 884.46 |
| IUPAC Name | 1-N',1-N'-bis[2-hydroxy-3-(4-methylphenyl)-2-[(4-methylphenyl)methyl]-3-naphthalen-1-ylpropyl]cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1ccc(CC(O)(CN(CC(O)(Cc2ccc(C)cc2)C(c2ccc(C)cc2)c2cccc3ccccc23)C(=O)C2(C(N)=O)CC2)C(c2ccc(C)cc2)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C61H60N2O4/c1-41-19-27-45(28-20-41)37-60(66,55(49-31-23-43(3)24-32-49)53-17-9-13-47-11-5-7-15-51(47)53)39-63(58(65)59(35-36-59)57(62)64)40-61(67,38-46-29-21-42(2)22-30-46)56(50-33-25-44(4)26-34-50)54-18-10-14-48-12-6-8-16-52(48)54/h5-34,55-56,66-67H,35-40H2,1-4H3,(H2,62,64) |
| InChIKey | ACYDJQVDIVYODD-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.16 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|