C27H32N2O4 — CID 66923872
1-N,1-N'-bis[(R)-(1-hydroxycyclobutyl)-phenylmethyl]cyclopropane-1,1-dicarboxamide (PubChem CID 66923872) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is 1-N,1-N'-bis[(R)-(1-hydroxycyclobutyl)-phenylmethyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N,1-N'-bis[(R)-(1-hydroxycyclobutyl)-phenylmethyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66923872 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 1-N,1-N'-bis[(R)-(1-hydroxycyclobutyl)-phenylmethyl]cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(N[C@H](c1ccccc1)C1(O)CCC1)C1(C(=O)N[C@H](c2ccccc2)C2(O)CCC2)CC1 |
| InChI | InChI=1S/C27H32N2O4/c30-23(28-21(26(32)13-7-14-26)19-9-3-1-4-10-19)25(17-18-25)24(31)29-22(27(33)15-8-16-27)20-11-5-2-6-12-20/h1-6,9-12,21-22,32-33H,7-8,13-18H2,(H,28,30)(H,29,31)/t21-,22-/m1/s1 |
| InChIKey | PVFBPYNJQASETE-FGZHOGPDSA-N |
| XLogP | 3.31 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|