C38H42N2O4 — CID 66923989
1-N',1-N'-bis[(2R)-1-hydroxy-1,1-diphenylpropan-2-yl]cyclohexane-1,1-dicarboxamide (PubChem CID 66923989) has the molecular formula C38H42N2O4 and a molecular weight of 590.76 g/mol. Its IUPAC name is 1-N',1-N'-bis[(2R)-1-hydroxy-1,1-diphenylpropan-2-yl]cyclohexane-1,1-dicarboxamide.
| Compound Name | 1-N',1-N'-bis[(2R)-1-hydroxy-1,1-diphenylpropan-2-yl]cyclohexane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66923989 |
| Molecular Formula | C38H42N2O4 |
| Molecular Weight | 590.76 g/mol |
| Exact Mass | 590.31 |
| IUPAC Name | 1-N',1-N'-bis[(2R)-1-hydroxy-1,1-diphenylpropan-2-yl]cyclohexane-1,1-dicarboxamide |
| SMILES | C[C@@H](N(C(=O)C1(C(N)=O)CCCCC1)[C@H](C)C(O)(c1ccccc1)c1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H42N2O4/c1-28(37(43,30-18-8-3-9-19-30)31-20-10-4-11-21-31)40(35(42)36(34(39)41)26-16-7-17-27-36)29(2)38(44,32-22-12-5-13-23-32)33-24-14-6-15-25-33/h3-6,8-15,18-25,28-29,43-44H,7,16-17,26-27H2,1-2H3,(H2,39,41)/t28-,29-/m1/s1 |
| InChIKey | BFHLUPNYSACAHT-FQLXRVMXSA-N |
| XLogP | 5.90 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.76 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|