C54H58N2O4 — CID 66923621
1-N',1-N'-bis[(2R)-1-hydroxy-1,1-bis(4-methylphenyl)-3-phenylpropan-2-yl]cyclohexane-1,1-dicarboxamide (PubChem CID 66923621) has the molecular formula C54H58N2O4 and a molecular weight of 799.07 g/mol. Its IUPAC name is 1-N',1-N'-bis[(2R)-1-hydroxy-1,1-bis(4-methylphenyl)-3-phenylpropan-2-yl]cyclohexane-1,1-dicarboxamide.
| Compound Name | 1-N',1-N'-bis[(2R)-1-hydroxy-1,1-bis(4-methylphenyl)-3-phenylpropan-2-yl]cyclohexane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66923621 |
| Molecular Formula | C54H58N2O4 |
| Molecular Weight | 799.07 g/mol |
| Exact Mass | 798.44 |
| IUPAC Name | 1-N',1-N'-bis[(2R)-1-hydroxy-1,1-bis(4-methylphenyl)-3-phenylpropan-2-yl]cyclohexane-1,1-dicarboxamide |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)[C@@H](Cc2ccccc2)N(C(=O)C2(C(N)=O)CCCCC2)[C@H](Cc2ccccc2)C(O)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C54H58N2O4/c1-38-18-26-44(27-19-38)53(59,45-28-20-39(2)21-29-45)48(36-42-14-8-5-9-15-42)56(51(58)52(50(55)57)34-12-7-13-35-52)49(37-43-16-10-6-11-17-43)54(60,46-30-22-40(3)23-31-46)47-32-24-41(4)25-33-47/h5-6,8-11,14-33,48-49,59-60H,7,12-13,34-37H2,1-4H3,(H2,55,57)/t48-,49-/m1/s1 |
| InChIKey | PXURZUYLCWGSOV-YYACYCFASA-N |
| XLogP | 9.58 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.07 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|