C48H62N2O4 — CID 77217456
1-N',1-N'-bis[1-hydroxy-4-methyl-1,1-bis(4-methylphenyl)pentan-2-yl]cyclohexane-1,1-dicarboxamide (PubChem CID 77217456) has the molecular formula C48H62N2O4 and a molecular weight of 731.03 g/mol. Its IUPAC name is 1-N',1-N'-bis[1-hydroxy-4-methyl-1,1-bis(4-methylphenyl)pentan-2-yl]cyclohexane-1,1-dicarboxamide.
| Compound Name | 1-N',1-N'-bis[1-hydroxy-4-methyl-1,1-bis(4-methylphenyl)pentan-2-yl]cyclohexane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 77217456 |
| Molecular Formula | C48H62N2O4 |
| Molecular Weight | 731.03 g/mol |
| Exact Mass | 730.47 |
| IUPAC Name | 1-N',1-N'-bis[1-hydroxy-4-methyl-1,1-bis(4-methylphenyl)pentan-2-yl]cyclohexane-1,1-dicarboxamide |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)C(CC(C)C)N(C(=O)C2(C(N)=O)CCCCC2)C(CC(C)C)C(O)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C48H62N2O4/c1-32(2)30-42(47(53,38-20-12-34(5)13-21-38)39-22-14-35(6)15-23-39)50(45(52)46(44(49)51)28-10-9-11-29-46)43(31-33(3)4)48(54,40-24-16-36(7)17-25-40)41-26-18-37(8)19-27-41/h12-27,32-33,42-43,53-54H,9-11,28-31H2,1-8H3,(H2,49,51) |
| InChIKey | AUZUWDUPDHFASS-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.03 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|