C52H54N2O4 — CID 77217598
1-N',1-N'-bis[1-hydroxy-1,1-bis(4-methylphenyl)-3-phenylpropan-2-yl]cyclobutane-1,1-dicarboxamide (PubChem CID 77217598) has the molecular formula C52H54N2O4 and a molecular weight of 771.01 g/mol. Its IUPAC name is 1-N',1-N'-bis[1-hydroxy-1,1-bis(4-methylphenyl)-3-phenylpropan-2-yl]cyclobutane-1,1-dicarboxamide.
| Compound Name | 1-N',1-N'-bis[1-hydroxy-1,1-bis(4-methylphenyl)-3-phenylpropan-2-yl]cyclobutane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 77217598 |
| Molecular Formula | C52H54N2O4 |
| Molecular Weight | 771.01 g/mol |
| Exact Mass | 770.41 |
| IUPAC Name | 1-N',1-N'-bis[1-hydroxy-1,1-bis(4-methylphenyl)-3-phenylpropan-2-yl]cyclobutane-1,1-dicarboxamide |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)C(Cc2ccccc2)N(C(=O)C2(C(N)=O)CCC2)C(Cc2ccccc2)C(O)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C52H54N2O4/c1-36-16-24-42(25-17-36)51(57,43-26-18-37(2)19-27-43)46(34-40-12-7-5-8-13-40)54(49(56)50(48(53)55)32-11-33-50)47(35-41-14-9-6-10-15-41)52(58,44-28-20-38(3)21-29-44)45-30-22-39(4)23-31-45/h5-10,12-31,46-47,57-58H,11,32-35H2,1-4H3,(H2,53,55) |
| InChIKey | BVZJXLBKZHMDMK-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.01 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|