C47H60N2O4 — CID 66923743
1-N',1-N'-bis[(2R)-1-hydroxy-4-methyl-1,1-bis(4-methylphenyl)pentan-2-yl]cyclopentane-1,1-dicarboxamide (PubChem CID 66923743) has the molecular formula C47H60N2O4 and a molecular weight of 717.01 g/mol. Its IUPAC name is 1-N',1-N'-bis[(2R)-1-hydroxy-4-methyl-1,1-bis(4-methylphenyl)pentan-2-yl]cyclopentane-1,1-dicarboxamide.
| Compound Name | 1-N',1-N'-bis[(2R)-1-hydroxy-4-methyl-1,1-bis(4-methylphenyl)pentan-2-yl]cyclopentane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66923743 |
| Molecular Formula | C47H60N2O4 |
| Molecular Weight | 717.01 g/mol |
| Exact Mass | 716.46 |
| IUPAC Name | 1-N',1-N'-bis[(2R)-1-hydroxy-4-methyl-1,1-bis(4-methylphenyl)pentan-2-yl]cyclopentane-1,1-dicarboxamide |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)[C@@H](CC(C)C)N(C(=O)C2(C(N)=O)CCCC2)[C@H](CC(C)C)C(O)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C47H60N2O4/c1-31(2)29-41(46(52,37-19-11-33(5)12-20-37)38-21-13-34(6)14-22-38)49(44(51)45(43(48)50)27-9-10-28-45)42(30-32(3)4)47(53,39-23-15-35(7)16-24-39)40-25-17-36(8)18-26-40/h11-26,31-32,41-42,52-53H,9-10,27-30H2,1-8H3,(H2,48,50)/t41-,42-/m1/s1 |
| InChIKey | KJJLYSWFNFGMMV-NCRNUEESSA-N |
| XLogP | 8.80 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.01 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|